* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | Z-PHE-LEU-ALA-OH |
CAS: | 24955-29-1 |
English Synonyms: | Z-PHE-LEU-ALA-OH ; CBZ-PHE-LEU-ALA |
MDL Number.: | MFCD00238498 |
H bond acceptor: | 9 |
H bond donor: | 4 |
Smile: | CC(C)C[C@@H](C(=O)N[C@@H](C)C(=O)O)NC(=O)[C@H](Cc1ccccc1)NC(=O)OCc2ccccc2 |
InChi: | InChI=1S/C26H33N3O6/c1-17(2)14-21(23(30)27-18(3)25(32)33)28-24(31)22(15-19-10-6-4-7-11-19)29-26(34)35-16-20-12-8-5-9-13-20/h4-13,17-18,21-22H,14-16H2,1-3H3,(H,27,30)(H,28,31)(H,29,34)(H,32,33)/t18-,21-,22-/m0/s1 |
InChiKey: | InChIKey=ZBAUSFDBAKHCHV-NYVOZVTQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.