* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | Z-PRO-GLY-GLY-OH |
CAS: | 37700-65-5 |
English Synonyms: | Z-PRO-GLY-GLY-OH |
MDL Number.: | MFCD00238502 |
H bond acceptor: | 9 |
H bond donor: | 3 |
Smile: | c1ccc(cc1)COC(=O)N2CCC[C@H]2C(=O)NCC(=O)NCC(=O)O |
InChi: | InChI=1S/C17H21N3O6/c21-14(18-10-15(22)23)9-19-16(24)13-7-4-8-20(13)17(25)26-11-12-5-2-1-3-6-12/h1-3,5-6,13H,4,7-11H2,(H,18,21)(H,19,24)(H,22,23)/t13-/m0/s1 |
InChiKey: | InChIKey=PWXBLRUHNLSORC-ZDUSSCGKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.