* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | MILLETTONE |
| CAS: | 50376-38-0 |
| English Synonyms: | MILLETTONE |
| MDL Number.: | MFCD00238643 |
| H bond acceptor: | 6 |
| H bond donor: | 0 |
| Smile: | CC1(C=Cc2c(ccc3c2O[C@@H]4COc5cc6c(cc5[C@@H]4C3=O)OCO6)O1)C |
| InChi: | InChI=1S/C22H18O6/c1-22(2)6-5-11-14(28-22)4-3-12-20(23)19-13-7-16-17(26-10-25-16)8-15(13)24-9-18(19)27-21(11)12/h3-8,18-19H,9-10H2,1-2H3/t18-,19+/m1/s1 |
| InChiKey: | InChIKey=TXNSUHKZCOMFPN-MOPGFXCFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.