* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VERTICILLATINE |
| CAS: | 10247-54-8 |
| English Synonyms: | VERTICILLATINE |
| MDL Number.: | MFCD00238704 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | COc1ccc2c(c1O)-c3cc(ccc3O)/C=C\C(=O)O[C@H]4C[C@H]5CCCCN5[C@H]2C4 |
| InChi: | InChI=1S/C25H27NO5/c1-30-22-9-7-18-20-14-17(13-16-4-2-3-11-26(16)20)31-23(28)10-6-15-5-8-21(27)19(12-15)24(18)25(22)29/h5-10,12,16-17,20,27,29H,2-4,11,13-14H2,1H3/b10-6-/t16-,17+,20+/m1/s1 |
| InChiKey: | InChIKey=WBNJBVAHRALIOS-HUFWVITFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.