* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VERTIOINONE |
| English Synonyms: | VERTIOINONE |
| MDL Number.: | MFCD00238705 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | C[C@H]1CC[C@H]2[C@@]([C@H]3CC[C@@H]4[C@H]([C@@H]3CN2C1)C[C@H]5[C@H]4C(=O)C[C@@H]6[C@@]5(CC[C@@H](C6)O)C)(C)O |
| InChi: | InChI=1S/C27H43NO3/c1-15-4-7-24-27(3,31)21-6-5-18-19(20(21)14-28(24)13-15)12-22-25(18)23(30)11-16-10-17(29)8-9-26(16,22)2/h15-22,24-25,29,31H,4-14H2,1-3H3/t15-,16+,17-,18+,19+,20-,21-,22-,24-,25-,26-,27-/m0/s1 |
| InChiKey: | InChIKey=YMHLDCNESNGRBR-GQGFYVDXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.