Molecular Structure:
CCD No.:CCD00109433
INULIN, [3H(G)]
Formula:C18 H30 O15 X2
MolWeight:486.42
![INULIN, [3H(G)] Detailed](../images/deli.png)
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | INULIN, [3H(G)] |
| English Synonyms： | INULIN, [3H(G)] |
| MDL Number.： | MFCD00239381 |
| H bond acceptor： | 15 |
| H bond donor： | 9 |
| Smile： | *C[C@@]1([C@H]([C@@H]([C@H](O1)CO)O)O)OC[C@@]2([C@H]([C@@H]([C@H](O2)CO)O)O)OC[C@@]3([C@H]([C@@H]([C@H](O3)CO)O)O)O* |
| InChiKey： | InChIKey=null |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
