* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ISOXSUPRINE |
CAS: | 395-28-8 |
English Synonyms: | ISOXSUPRINE |
MDL Number.: | MFCD00242894 |
H bond acceptor: | 4 |
H bond donor: | 3 |
Smile: | CC(COc1ccccc1)NC(C)C(c2ccc(cc2)O)O |
InChi: | InChI=1S/C18H23NO3/c1-13(12-22-17-6-4-3-5-7-17)19-14(2)18(21)15-8-10-16(20)11-9-15/h3-11,13-14,18-21H,12H2,1-2H3 |
InChiKey: | InChIKey=BMUKKTUHUDJSNZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.