* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | COUMITHOATE |
CAS: | 572-48-5 |
English Synonyms: | COUMITHOATE |
MDL Number.: | MFCD00242903 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | CCOP(=S)(OCC)Oc1ccc2c(c1)oc(=O)c3c2CCCC3 |
InChi: | InChI=1S/C17H21O5PS/c1-3-19-23(24,20-4-2)22-12-9-10-14-13-7-5-6-8-15(13)17(18)21-16(14)11-12/h9-11H,3-8H2,1-2H3 |
InChiKey: | InChIKey=NSMRHYDOKZAMKJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.