* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BIETASERPINE |
| CAS: | 53-18-9 |
| English Synonyms: | BIETASERPINE |
| MDL Number.: | MFCD00242906 |
| H bond acceptor: | 12 |
| H bond donor: | 0 |
| Smile: | CCN(CC)CCn1c2cc(ccc2c3c1[C@H]4C[C@H]5[C@H](C[C@H]([C@@H]([C@H]5C(=O)OC)OC)OC(=O)c6cc(c(c(c6)OC)OC)OC)CN4CC3)OC |
| InChi: | InChI=1S/C39H53N3O9/c1-9-40(10-2)15-16-42-29-20-25(45-3)11-12-26(29)27-13-14-41-22-24-19-33(37(49-7)34(39(44)50-8)28(24)21-30(41)35(27)42)51-38(43)23-17-31(46-4)36(48-6)32(18-23)47-5/h11-12,17-18,20,24,28,30,33-34,37H,9-10,13-16,19,21-22H2,1-8H3/t24-,28+,30-,33-,34+,37+/m1/s1 |
| InChiKey: | InChIKey=WFTSRDISOMSAQC-ZNFOTRSXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.