* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z,E-9,11-TETRADECADIENYL ACETATE |
| CAS: | 50767-79-8 |
| English Synonyms: | Z,E-9,11-TETRADECADIENYL ACETATE |
| MDL Number.: | MFCD00242972 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | CC/C=C\C=C\CCCCCCCCOC(=O)C |
| InChi: | InChI=1S/C16H28O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-18-16(2)17/h4-7H,3,8-15H2,1-2H3/b5-4-,7-6+ |
| InChiKey: | InChIKey=RFEQLTBBKNKGGJ-SCFJQAPRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.