* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-(1-(3-METHYLPHENOXY)ETHYL)(1,2,4)TRIAZOLO[1,5-A]PYRIMIDIN-2-AMINE |
| English Synonyms: | 7-(1-(3-METHYLPHENOXY)ETHYL)(1,2,4)TRIAZOLO[1,5-A]PYRIMIDIN-2-AMINE |
| MDL Number.: | MFCD00243581 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | Cc1cccc(c1)OC(C)c2ccnc3n2nc(n3)N |
| InChi: | InChI=1S/C14H15N5O/c1-9-4-3-5-11(8-9)20-10(2)12-6-7-16-14-17-13(15)18-19(12)14/h3-8,10H,1-2H3,(H2,15,18) |
| InChiKey: | InChIKey=ZJRYBPAIBUZCOY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.