* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 7-(1-(3,5-DIMETHYLPHENOXY)ETHYL)-(1,2,4)TRIAZOLO[1,5-A]PYRIMIDIN-2-AMINE |
English Synonyms: | 7-(1-(3,5-DIMETHYLPHENOXY)ETHYL)-(1,2,4)TRIAZOLO[1,5-A]PYRIMIDIN-2-AMINE |
MDL Number.: | MFCD00243587 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | Cc1cc(cc(c1)OC(C)c2ccnc3n2nc(n3)N)C |
InChi: | InChI=1S/C15H17N5O/c1-9-6-10(2)8-12(7-9)21-11(3)13-4-5-17-15-18-14(16)19-20(13)15/h4-8,11H,1-3H3,(H2,16,19) |
InChiKey: | InChIKey=KDUIDBRJNDIFTO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.