* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 7-CHLORO-2-SULFANYL-4H-PYRIDO[1,2-A](1,3,5)TRIAZIN-4-ONE |
English Synonyms: | 7-CHLORO-2-SULFANYL-4H-PYRIDO[1,2-A](1,3,5)TRIAZIN-4-ONE |
MDL Number.: | MFCD00244106 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | c1cc2nc(nc(=O)n2cc1Cl)S |
InChi: | InChI=1S/C7H4ClN3OS/c8-4-1-2-5-9-6(13)10-7(12)11(5)3-4/h1-3H,(H,10,12,13) |
InChiKey: | InChIKey=NHAMAXZUHBEIFL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.