* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ETHYL 2-((7-METHYL-4-OXO-4H-PYRIDO[1,2-A](1,3,5)TRIAZIN-2-YL)SULFANYL)ACETATE |
| CAS: | 306979-25-9 |
| English Synonyms: | ETHYL 2-((7-METHYL-4-OXO-4H-PYRIDO[1,2-A](1,3,5)TRIAZIN-2-YL)SULFANYL)ACETATE |
| MDL Number.: | MFCD00244113 |
| H bond acceptor: | 6 |
| H bond donor: | 0 |
| Smile: | CCOC(=O)CSc1nc2ccc(cn2c(=O)n1)C |
| InChi: | InChI=1S/C12H13N3O3S/c1-3-18-10(16)7-19-11-13-9-5-4-8(2)6-15(9)12(17)14-11/h4-6H,3,7H2,1-2H3 |
| InChiKey: | InChIKey=IXHCALYUNCMXQO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.