* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 7-METHYL-2-(PROPYLSULFANYL)-4H-PYRIDO[1,2-A](1,3,5)TRIAZIN-4-ONE |
English Synonyms: | 7-METHYL-2-(PROPYLSULFANYL)-4H-PYRIDO[1,2-A](1,3,5)TRIAZIN-4-ONE |
MDL Number.: | MFCD00244117 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | CCCSc1nc2ccc(cn2c(=O)n1)C |
InChi: | InChI=1S/C11H13N3OS/c1-3-6-16-10-12-9-5-4-8(2)7-14(9)11(15)13-10/h4-5,7H,3,6H2,1-2H3 |
InChiKey: | InChIKey=AWCUVYFSMMWUGM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.