* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 7-CHLORO-2-METHYL-3-(1,3-THIAZOL-2-YL)-4(3H)-QUINAZOLINONE |
English Synonyms: | 7-CHLORO-2-METHYL-3-(1,3-THIAZOL-2-YL)-4(3H)-QUINAZOLINONE |
MDL Number.: | MFCD00244173 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | Cc1nc2cc(ccc2c(=O)n1c3nccs3)Cl |
InChi: | InChI=1S/C12H8ClN3OS/c1-7-15-10-6-8(13)2-3-9(10)11(17)16(7)12-14-4-5-18-12/h2-6H,1H3 |
InChiKey: | InChIKey=VDOUGXWXWQAGHC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.