* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ETHYL 3-(1H-PYRROL-1-YL)-1H-INDOLE-2-CARBOXYLATE |
| English Synonyms: | ETHYL 3-(1H-PYRROL-1-YL)-1H-INDOLE-2-CARBOXYLATE |
| MDL Number.: | MFCD00244795 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCOC(=O)c1c(c2ccccc2[nH]1)n3cccc3 |
| InChi: | InChI=1S/C15H14N2O2/c1-2-19-15(18)13-14(17-9-5-6-10-17)11-7-3-4-8-12(11)16-13/h3-10,16H,2H2,1H3 |
| InChiKey: | InChIKey=ZIXYIOCYCBVYEO-UHFFFAOYSA-N |
|
|
| Melting Point: | 105-107 DEG |
| Comments: | WARNINGS: IRRITANT |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.