* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VICENISTATIN |
| English Synonyms: | VICENISTATIN |
| MDL Number.: | MFCD00270916 |
| H bond acceptor: | 6 |
| H bond donor: | 3 |
| Smile: | CC1CC/C=C\C=C(\C/C(=C/CC(C(/C=C/C=C/C(=O)NC1)C)O[C@H]2C[C@@H]([C@@H]([C@H](O2)C)NC)O)/C)/C |
| InChi: | InChI=1S/C30H48N2O4/c1-21-12-8-7-9-13-23(3)20-32-28(34)15-11-10-14-24(4)27(17-16-22(2)18-21)36-29-19-26(33)30(31-6)25(5)35-29/h7-8,10-12,14-16,23-27,29-31,33H,9,13,17-20H2,1-6H3,(H,32,34)/b8-7-,14-10+,15-11+,21-12+,22-16+/t23?,24?,25-,26+,27?,29+,30-/m1/s1 |
| InChiKey: | InChIKey=FINGADBUNZWVLV-GXHVBTRZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.