* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | EMOLECULES 37036627 |
| English Synonyms: | EMOLECULES 37036627 |
| MDL Number.: | MFCD00271034 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | CO[Si](CCC[S+]=C(N)N)(OC)OC.[Cl-] |
| InChi: | InChI=1S/C7H19N2O3SSi.ClH/c1-10-14(11-2,12-3)6-4-5-13-7(8)9;/h4-6,8-9H2,1-3H3;1H/q+1;/p-1 |
| InChiKey: | InChIKey=BNHAHFSCGSJSMN-UHFFFAOYSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.