* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ESTRAN-5BETA,10BETA-EPOXY-3,17-DIONE |
| English Synonyms: | ESTRAN-5BETA,10BETA-EPOXY-3,17-DIONE |
| MDL Number.: | MFCD00271590 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | C[C@]12CC[C@H]3[C@H]([C@@H]1CCC2=O)CC[C@]45[C@]3(O4)CCC(=O)C5 |
| InChi: | InChI=1S/C18H24O3/c1-16-7-6-14-12(13(16)2-3-15(16)20)5-8-17-10-11(19)4-9-18(14,17)21-17/h12-14H,2-10H2,1H3/t12-,13-,14-,16-,17-,18-/m0/s1 |
| InChiKey: | InChIKey=IMUXYKVAQDXODL-URZJPPTPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.