* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9(11),(5BETA)-PREGNEN-3ALPHA,20BETA,21-TRIOL |
English Synonyms: | 9(11),(5BETA)-PREGNEN-3ALPHA,20BETA,21-TRIOL |
MDL Number.: | MFCD00272113 |
H bond acceptor: | 3 |
H bond donor: | 3 |
Smile: | C[C@]12CC[C@H](C[C@H]1CC[C@@H]3C2=CC[C@]4([C@H]3CC[C@@H]4[C@@H](CO)O)C)O |
InChi: | InChI=1S/C21H34O3/c1-20-9-7-14(23)11-13(20)3-4-15-16-5-6-18(19(24)12-22)21(16,2)10-8-17(15)20/h8,13-16,18-19,22-24H,3-7,9-12H2,1-2H3/t13-,14-,15+,16+,18-,19-,20+,21+/m1/s1 |
InChiKey: | InChIKey=NIHOLJQQDQOWDU-GRPNHFIBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.