* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WILFORLIDE A |
CAS: | 84104-71-2 |
English Synonyms: | WILFORLIDE A ; (3BETA,22ALPHA)-3-HYDROXY-22,29-EPOXYOLEAN-12-EN-29-ONE |
MDL Number.: | MFCD00272168 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CC1([C@@H]2CC[C@@]3([C@@H]([C@]2(CC[C@@H]1O)C)CC=C4[C@]3(CC[C@@]5([C@H]4C[C@]6(C[C@@H]5OC6=O)C)C)C)C)C |
InChi: | InChI=1S/C30H46O3/c1-25(2)20-10-13-30(7)21(28(20,5)12-11-22(25)31)9-8-18-19-16-26(3)17-23(33-24(26)32)27(19,4)14-15-29(18,30)6/h8,19-23,31H,9-17H2,1-7H3/t19-,20-,21+,22-,23-,26-,27+,28-,29+,30+/m0/s1 |
InChiKey: | InChIKey=HHQJBWYXBWOFJY-YLXTXNMFSA-N |
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.