* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7,3'-DIHYDROXYISOFLAVAN |
| CAS: | 89019-82-9 |
| English Synonyms: | 7,3'-DIHYDROXYISOFLAVAN |
| MDL Number.: | MFCD00272172 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | c1cc(cc(c1)O)C2Cc3ccc(cc3OC2)O |
| InChi: | InChI=1S/C15H14O3/c16-13-3-1-2-10(7-13)12-6-11-4-5-14(17)8-15(11)18-9-12/h1-5,7-8,12,16-17H,6,9H2 |
| InChiKey: | InChIKey=BMWNMQFETMHGID-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.