* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | QUASSINE |
| English Synonyms: | QUASSINE |
| MDL Number.: | MFCD00273126 |
| H bond acceptor: | 6 |
| H bond donor: | 0 |
| Smile: | C[C@@H]1C=C(C(=O)[C@]2([C@H]1C[C@@H]3[C@@]4([C@@H]2C(=O)C(=C([C@@H]4CC(=O)O3)C)OC)C)C)OC |
| InChi: | InChI=1S/C22H28O6/c1-10-7-14(26-5)20(25)22(4)12(10)8-15-21(3)13(9-16(23)28-15)11(2)18(27-6)17(24)19(21)22/h7,10,12-13,15,19H,8-9H2,1-6H3/t10-,12+,13+,15-,19+,21-,22+/m1/s1 |
| InChiKey: | InChIKey=IOSXSVZRTUWBHC-LBTVDEKVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.