* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | GLY-LEU-ARG-HYP-GLY-NH2 |
English Synonyms: | GLY-LEU-ARG-HYP-GLY-NH2 ; [HYP9]LHRH (6-10) |
MDL Number.: | MFCD00273682 |
H bond acceptor: | 15 |
H bond donor: | 9 |
Smile: | CC(C)C[C@@H](C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1[C@@H](CC[C@H]1O)C(=O)NCC(=O)N)NC(=O)CN |
InChi: | InChI=1S/C21H39N9O6/c1-11(2)8-13(28-16(32)9-22)18(34)29-12(4-3-7-26-21(24)25)20(36)30-14(5-6-17(30)33)19(35)27-10-15(23)31/h11-14,17,33H,3-10,22H2,1-2H3,(H2,23,31)(H,27,35)(H,28,32)(H,29,34)(H4,24,25,26)/t12-,13-,14-,17+/m0/s1 |
InChiKey: | InChIKey=CBUJIQIJIKJVMQ-AYMQEEERSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.