* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ILE-TYR-PRO-ARG-TYR |
| CAS: | 144525-68-8 |
| English Synonyms: | ILE-TYR-PRO-ARG-TYR |
| MDL Number.: | MFCD00274431 |
| H bond acceptor: | 16 |
| H bond donor: | 10 |
| Smile: | CC[C@H](C)[C@@H](C(=O)N[C@@H](Cc1ccc(cc1)O)C(=O)N2CCC[C@H]2C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc3ccc(cc3)O)C(=O)O)N |
| InChi: | InChI=1S/C35H50N8O8/c1-3-20(2)29(36)32(48)41-26(18-21-8-12-23(44)13-9-21)33(49)43-17-5-7-28(43)31(47)40-25(6-4-16-39-35(37)38)30(46)42-27(34(50)51)19-22-10-14-24(45)15-11-22/h8-15,20,25-29,44-45H,3-7,16-19,36H2,1-2H3,(H,40,47)(H,41,48)(H,42,46)(H,50,51)(H4,37,38,39)/t20-,25-,26-,27-,28-,29-/m0/s1 |
| InChiKey: | InChIKey=MHTGCGBUKAKZJN-KOQQHMENSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.