* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 7-(2,4-DINITROPHENOXY)-1,1,2,2,3,3,4,4,5,5,6,6-DODECAFLUOROHEPTANE |
English Synonyms: | 7-(2,4-DINITROPHENOXY)-1,1,2,2,3,3,4,4,5,5,6,6-DODECAFLUOROHEPTANE |
MDL Number.: | MFCD00277270 |
H bond acceptor: | 7 |
H bond donor: | 0 |
Smile: | c1cc(c(cc1[N+](=O)[O-])[N+](=O)[O-])OCC(C(C(C(C(C(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
InChi: | InChI=1S/C13H6F12N2O5/c14-8(15)10(18,19)12(22,23)13(24,25)11(20,21)9(16,17)4-32-7-2-1-5(26(28)29)3-6(7)27(30)31/h1-3,8H,4H2 |
InChiKey: | InChIKey=CINBCMXPOAFIGY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.