* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 7-CHLORO-3-(3-NITROPHENYL)-4H-PYRIDAZINO[6,1-C][1,2,4]TRIAZINE |
English Synonyms: | 7-CHLORO-3-(3-NITROPHENYL)-4H-PYRIDAZINO[6,1-C][1,2,4]TRIAZINE |
MDL Number.: | MFCD00277888 |
H bond acceptor: | 7 |
H bond donor: | 0 |
Smile: | c1cc(cc(c1)[N+](=O)[O-])C2=NN=C3C=CC(=NN3C2)Cl |
InChi: | InChI=1S/C12H8ClN5O2/c13-11-4-5-12-15-14-10(7-17(12)16-11)8-2-1-3-9(6-8)18(19)20/h1-6H,7H2 |
InChiKey: | InChIKey=ILQJWCQSOXBJSG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.