* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ET 7-ME-3-OXO-5-PH-2,3-DIHYDRO-5H-(1,3)THIAZOLO(3,2-A)PYRIMIDINE-6-CARBOXYLATE |
| English Synonyms: | ET 7-ME-3-OXO-5-PH-2,3-DIHYDRO-5H-(1,3)THIAZOLO(3,2-A)PYRIMIDINE-6-CARBOXYLATE |
| MDL Number.: | MFCD00299989 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | CCOC(=O)C1=C(N=C2N(C1c3ccccc3)C(=O)CS2)C |
| InChi: | InChI=1S/C16H16N2O3S/c1-3-21-15(20)13-10(2)17-16-18(12(19)9-22-16)14(13)11-7-5-4-6-8-11/h4-8,14H,3,9H2,1-2H3 |
| InChiKey: | InChIKey=AYLZZJGWMCMKFX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.