Molecular Structure:
CCD No.:CCD00125668
RCL L112372
Formula:C42 H28 N2 O4
MolWeight:624.693
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | RCL L112372 |
| English Synonyms： | RCL L112372 |
| MDL Number.： | MFCD00304259 |
| H bond acceptor： | 6 |
| H bond donor： | 0 |
| Smile： | c1ccc2c(c1)C3c4ccccc4C2C5C3C(=O)N(C5=O)c6cccc(c6)N7C(=O)C8C9c1ccccc1C(C8C7=O)c1c9cccc1 |
| InChi： | InChI=1S/C42H28N2O4/c45-39-35-31-23-12-1-2-13-24(23)32(26-15-4-3-14-25(26)31)36(35)40(46)43(39)21-10-9-11-22(20-21)44-41(47)37-33-27-16-5-6-17-28(27)34(38(37)42(44)48)30-19-8-7-18-29(30)33/h1-20,31-38H |
| InChiKey： | InChIKey=YQFLCSWNWLBZNM-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
