* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RCL L337048 |
| English Synonyms: | RCL L337048 |
| MDL Number.: | MFCD00304377 |
| H bond acceptor: | 12 |
| H bond donor: | 4 |
| Smile: | c1cc(ccc1C(=O)O)NC(=O)CCCCCN2C(=O)/C(=C\3/C(=O)N(C(=S)S3)CCCCCC(=O)Nc4ccc(cc4)C(=O)O)/SC2=S |
| InChi: | InChI=1S/C32H32N4O8S4/c37-23(33-21-13-9-19(10-14-21)29(41)42)7-3-1-5-17-35-27(39)25(47-31(35)45)26-28(40)36(32(46)48-26)18-6-2-4-8-24(38)34-22-15-11-20(12-16-22)30(43)44/h9-16H,1-8,17-18H2,(H,33,37)(H,34,38)(H,41,42)(H,43,44)/b26-25+ |
| InChiKey: | InChIKey=VBROLCAYIWLTBK-OCEACIFDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.