* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RCL L336939 |
| English Synonyms: | RCL L336939 |
| MDL Number.: | MFCD00304392 |
| H bond acceptor: | 14 |
| H bond donor: | 6 |
| Smile: | c1ccc(c(c1)C(=O)NNC(=O)CCCCCN2C(=O)/C(=C\3/C(=O)N(C(=S)S3)CCCCCC(=O)NNC(=O)c4ccccc4O)/SC2=S)O |
| InChi: | InChI=1S/C32H34N6O8S4/c39-21-13-7-5-11-19(21)27(43)35-33-23(41)15-3-1-9-17-37-29(45)25(49-31(37)47)26-30(46)38(32(48)50-26)18-10-2-4-16-24(42)34-36-28(44)20-12-6-8-14-22(20)40/h5-8,11-14,39-40H,1-4,9-10,15-18H2,(H,33,41)(H,34,42)(H,35,43)(H,36,44)/b26-25+ |
| InChiKey: | InChIKey=YHIZHBWKAJHQML-OCEACIFDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.