Molecular Structure:
CCD No.:CCD00125687
RCL L336912
Formula:C22 H24 N8 O4 S6
MolWeight:656.88
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | RCL L336912 |
| English Synonyms： | RCL L336912 |
| MDL Number.： | MFCD00307158 |
| H bond acceptor： | 12 |
| H bond donor： | 2 |
| Smile： | CCc1nnc(s1)NC(=O)CCCN2C(=O)/C(=C\3/C(=O)N(C(=S)S3)CCCC(=O)Nc4nnc(s4)CC)/SC2=S |
| InChi： | InChI=1S/C22H24N8O4S6/c1-3-13-25-27-19(37-13)23-11(31)7-5-9-29-17(33)15(39-21(29)35)16-18(34)30(22(36)40-16)10-6-8-12(32)24-20-28-26-14(4-2)38-20/h3-10H2,1-2H3,(H,23,27,31)(H,24,28,32)/b16-15+ |
| InChiKey： | InChIKey=IZOGTMJCEJADRZ-FOCLMDBBSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
