* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RCL L337102 |
| English Synonyms: | RCL L337102 |
| MDL Number.: | MFCD00307186 |
| H bond acceptor: | 8 |
| H bond donor: | 2 |
| Smile: | c1ccc(cc1)NC(=O)CCCN2C(=O)/C(=C\3/C(=O)N(C(=S)S3)CCCC(=O)Nc4ccccc4)/SC2=S |
| InChi: | InChI=1S/C26H24N4O4S4/c31-19(27-17-9-3-1-4-10-17)13-7-15-29-23(33)21(37-25(29)35)22-24(34)30(26(36)38-22)16-8-14-20(32)28-18-11-5-2-6-12-18/h1-6,9-12H,7-8,13-16H2,(H,27,31)(H,28,32)/b22-21+ |
| InChiKey: | InChIKey=LITFKAHHOOWROR-QURGRASLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.