Molecular Structure:
CCD No.:CCD00125696
RCL L336823
Formula:C24 H20 N4 O6 S4
MolWeight:588.708
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | RCL L336823 |
| English Synonyms： | RCL L336823 |
| MDL Number.： | MFCD00307199 |
| H bond acceptor： | 10 |
| H bond donor： | 4 |
| Smile： | c1ccc(c(c1)NC(=O)CCN2C(=O)/C(=C\3/C(=O)N(C(=S)S3)CCC(=O)Nc4ccccc4O)/SC2=S)O |
| InChi： | InChI=1S/C24H20N4O6S4/c29-15-7-3-1-5-13(15)25-17(31)9-11-27-21(33)19(37-23(27)35)20-22(34)28(24(36)38-20)12-10-18(32)26-14-6-2-4-8-16(14)30/h1-8,29-30H,9-12H2,(H,25,31)(H,26,32)/b20-19+ |
| InChiKey： | InChIKey=XLWIFMILXUEGDQ-FMQUCBEESA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
