Molecular Structure:
CCD No.:CCD00125699
RCL L337056
Formula:C30 H32 N4 O6 S4
MolWeight:672.869
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | RCL L337056 |
| English Synonyms： | RCL L337056 |
| MDL Number.： | MFCD00307204 |
| H bond acceptor： | 10 |
| H bond donor： | 4 |
| Smile： | c1cc(cc(c1)O)NC(=O)CCCCCN2C(=O)/C(=C\3/C(=O)N(C(=S)S3)CCCCCC(=O)Nc4cccc(c4)O)/SC2=S |
| InChi： | InChI=1S/C30H32N4O6S4/c35-21-11-7-9-19(17-21)31-23(37)13-3-1-5-15-33-27(39)25(43-29(33)41)26-28(40)34(30(42)44-26)16-6-2-4-14-24(38)32-20-10-8-12-22(36)18-20/h7-12,17-18,35-36H,1-6,13-16H2,(H,31,37)(H,32,38)/b26-25+ |
| InChiKey： | InChIKey=YVSLQHRCYKTTDO-OCEACIFDSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
