Molecular Structure:
CCD No.:CCD00125702
RCL L336866
Formula:C24 H18 N6 O8 S4
MolWeight:646.704
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | RCL L336866 |
| English Synonyms： | RCL L336866 |
| MDL Number.： | MFCD00307216 |
| H bond acceptor： | 14 |
| H bond donor： | 2 |
| Smile： | c1ccc(c(c1)NC(=O)CCN2C(=O)/C(=C\3/C(=O)N(C(=S)S3)CCC(=O)Nc4ccccc4[N+](=O)[O-])/SC2=S)[N+](=O)[O-] |
| InChi： | InChI=1S/C24H18N6O8S4/c31-17(25-13-5-1-3-7-15(13)29(35)36)9-11-27-21(33)19(41-23(27)39)20-22(34)28(24(40)42-20)12-10-18(32)26-14-6-2-4-8-16(14)30(37)38/h1-8H,9-12H2,(H,25,31)(H,26,32)/b20-19+ |
| InChiKey： | InChIKey=MHZKUTKYISUHJG-FMQUCBEESA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
