* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB018699 |
| English Synonyms: | VITAS-BB TBB018699 |
| MDL Number.: | MFCD00370022 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | O=C(NC1=C(NC(=O)\C=C\C2=CC=CO2)C=CC=C1)\C=C\C1=CC=CO1 |
| InChi: | InChI=1S/C20H16N2O4/c23-19(11-9-15-5-3-13-25-15)21-17-7-1-2-8-18(17)22-20(24)12-10-16-6-4-14-26-16/h1-14H,(H,21,23)(H,22,24)/b11-9+,12-10+ |
| InChiKey: | InChIKey=MJODVAOBVHVUME-WGDLNXRISA-N |
* If the product has intellectual property rights, a license granted is must or contact us.