* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | INDOCATE |
CAS: | 31386-25-1 |
English Synonyms: | INDOCATE |
MDL Number.: | MFCD00371840 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | Cc1c(n(c2c1cc(cc2)C(=O)OCCN(C)C)Cc3ccccc3)C |
InChi: | InChI=1S/C22H26N2O2/c1-16-17(2)24(15-18-8-6-5-7-9-18)21-11-10-19(14-20(16)21)22(25)26-13-12-23(3)4/h5-11,14H,12-13,15H2,1-4H3 |
InChiKey: | InChIKey=YKWQHMLRAPIWDP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.