* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB035828 |
English Synonyms: | VITAS-BB TBB035828 |
MDL Number.: | MFCD00375982 |
H bond acceptor: | 9 |
H bond donor: | 3 |
Smile: | CC(C)COC(=O)C1=C(C)NC(=O)NC1C1=CC=C(O)C(=C1)[N+]([O-])=O |
InChi: | InChI=1S/C16H19N3O6/c1-8(2)7-25-15(21)13-9(3)17-16(22)18-14(13)10-4-5-12(20)11(6-10)19(23)24/h4-6,8,14,20H,7H2,1-3H3,(H2,17,18,22) |
InChiKey: | InChIKey=JQXBFRJZWIJHFT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.