* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB016534 |
| English Synonyms: | VITAS-BB TBB016534 |
| MDL Number.: | MFCD00379697 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | CC(C)(C)C1=CC(\C=N\NC(=O)C2=CC=CO2)=CC(=C1O)C(C)(C)C |
| InChi: | InChI=1S/C20H26N2O3/c1-19(2,3)14-10-13(11-15(17(14)23)20(4,5)6)12-21-22-18(24)16-8-7-9-25-16/h7-12,23H,1-6H3,(H,22,24)/b21-12+ |
| InChiKey: | InChIKey=GKKWEIURTBFVIF-CIAFOILYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.