* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB035823 |
English Synonyms: | VITAS-BB TBB035823 |
MDL Number.: | MFCD00381780 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | CCCCOC(=O)C1=C(C)NC(=O)NC1C1=CC=C(OCCC)C=C1 |
InChi: | InChI=1S/C19H26N2O4/c1-4-6-12-25-18(22)16-13(3)20-19(23)21-17(16)14-7-9-15(10-8-14)24-11-5-2/h7-10,17H,4-6,11-12H2,1-3H3,(H2,20,21,23) |
InChiKey: | InChIKey=LKHCTYNKJPGINX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.