* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB017159 |
English Synonyms: | VITAS-BB TBB017159 |
MDL Number.: | MFCD00385578 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | O=C(N\N=C\C1=CC=C2OCOC2=C1)C1=C2C=CC=CC2=CC=C1 |
InChi: | InChI=1S/C19H14N2O3/c22-19(16-7-3-5-14-4-1-2-6-15(14)16)21-20-11-13-8-9-17-18(10-13)24-12-23-17/h1-11H,12H2,(H,21,22)/b20-11+ |
InChiKey: | InChIKey=ZFKDUSKLWBMYRP-RGVLZGJSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.