* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB023542 |
English Synonyms: | VITAS-BB TBB023542 |
MDL Number.: | MFCD00386396 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | FC(F)(F)C1(C2CC(C=C2)N1S(=O)(=O)C1=CC=CC=C1)C(F)(F)Cl |
InChi: | InChI=1S/C14H11ClF5NO2S/c15-13(16,17)12(14(18,19)20)9-6-7-10(8-9)21(12)24(22,23)11-4-2-1-3-5-11/h1-7,9-10H,8H2 |
InChiKey: | InChIKey=KYWABYLIEAVAEM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.