* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ETHYL 4-(2,4-DIOXO-3-AZATRICYCLO[7.3.1.0(5,13)]TRIDECA-1(13),5,7,9,11-PENTAEN-3-YL)BUTANOATE |
| CAS: | 150705-10-5 |
| English Synonyms: | ETHYL 4-(2,4-DIOXO-3-AZATRICYCLO[7.3.1.0(5,13)]TRIDECA-1(13),5,7,9,11-PENTAEN-3-YL)BUTANOATE |
| MDL Number.: | MFCD00392161 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | CCOC(=O)CCCN1C(=O)c2cccc3c2c(ccc3)C1=O |
| InChi: | InChI=1S/C18H17NO4/c1-2-23-15(20)10-5-11-19-17(21)13-8-3-6-12-7-4-9-14(16(12)13)18(19)22/h3-4,6-9H,2,5,10-11H2,1H3 |
| InChiKey: | InChIKey=GPSQYFSWXQQJIQ-UHFFFAOYSA-N |
|
|
| Melting Point: | 91-92 DEG |
| Comments: | WARNINGS: IRRITANT |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.