* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX E/6022378 |
English Synonyms: | ZERENEX E/6022378 |
MDL Number.: | MFCD00395845 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1ccc2c(c1)c(c(s2)C(=O)Nc3cccc(c3)C(F)(F)F)Cl |
InChi: | InChI=1S/C16H9ClF3NOS/c17-13-11-6-1-2-7-12(11)23-14(13)15(22)21-10-5-3-4-9(8-10)16(18,19)20/h1-8H,(H,21,22) |
InChiKey: | InChIKey=JNKXWYSJBPCXIJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.