* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB017141 |
English Synonyms: | VITAS-BB TBB017141 |
MDL Number.: | MFCD00398602 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | [O-][N+](=O)C1=CC(\C=N\NC(=O)C2=CNC3=C2C=CC=C3)=CC=C1 |
InChi: | InChI=1S/C16H12N4O3/c21-16(14-10-17-15-7-2-1-6-13(14)15)19-18-9-11-4-3-5-12(8-11)20(22)23/h1-10,17H,(H,19,21)/b18-9+ |
InChiKey: | InChIKey=JXESNBIABDNWPC-GIJQJNRQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.