* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX E/6026442 |
| English Synonyms: | ZERENEX E/6026442 |
| MDL Number.: | MFCD00398777 |
| H bond acceptor: | 4 |
| H bond donor: | 3 |
| Smile: | c1ccc2c(c1)c3c([nH]2)C(NC(C3)C(=O)O)c4ccc(cc4)Br |
| InChi: | InChI=1S/C18H15BrN2O2/c19-11-7-5-10(6-8-11)16-17-13(9-15(21-16)18(22)23)12-3-1-2-4-14(12)20-17/h1-8,15-16,20-21H,9H2,(H,22,23) |
| InChiKey: | InChIKey=FPBHUDMWBLCBLN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.