* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB015153 |
| English Synonyms: | VITAS-BB TBB015153 |
| MDL Number.: | MFCD00406814 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | CN1\C(SC2=C1C=CC=C2)=C\C=C1\SC(=S)N(CC=C)C1=O |
| InChi: | InChI=1S/C16H14N2OS3/c1-3-10-18-15(19)13(22-16(18)20)8-9-14-17(2)11-6-4-5-7-12(11)21-14/h3-9H,1,10H2,2H3/b13-8+,14-9- |
| InChiKey: | InChIKey=QXPJRQXNDYIIPF-MGDWIPCISA-N |
* If the product has intellectual property rights, a license granted is must or contact us.