* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB023776 |
| English Synonyms: | VITAS-BB TBB023776 |
| MDL Number.: | MFCD00407655 |
| H bond acceptor: | 8 |
| H bond donor: | 1 |
| Smile: | CC(OS(=O)(=O)C1=CC=C(NC(C)=O)C=C1)C(F)(F)[N+]([O-])=O |
| InChi: | InChI=1S/C11H12F2N2O6S/c1-7(11(12,13)15(17)18)21-22(19,20)10-5-3-9(4-6-10)14-8(2)16/h3-7H,1-2H3,(H,14,16) |
| InChiKey: | InChIKey=OBTUATROCWNBEN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.